C45H46O4S2 — CID 129119967
2,12-bis(3-ethyl-3-methoxypent-1-ynyl)-7-(4-propan-2-ylphenyl)sulfonyl-6-thiapentacyclo[11.8.0.03,11.05,9.015,20]henicosa-1(21),2,4,7,9,11,13,15,17,19-decaene (PubChem CID 129119967) has the molecular formula C45H46O4S2 and a molecular weight of 714.99 g/mol. Its IUPAC name is 2,12-bis(3-ethyl-3-methoxypent-1-ynyl)-7-(4-propan-2-ylphenyl)sulfonyl-6-thiapentacyclo[11.8.0.03,11.05,9.015,20]henicosa-1(21),2,4,7,9,11,13,15,17,19-decaene.
| Compound Name | 2,12-bis(3-ethyl-3-methoxypent-1-ynyl)-7-(4-propan-2-ylphenyl)sulfonyl-6-thiapentacyclo[11.8.0.03,11.05,9.015,20]henicosa-1(21),2,4,7,9,11,13,15,17,19-decaene |
|---|---|
| PubChem CID | 129119967 |
| Molecular Formula | C45H46O4S2 |
| Molecular Weight | 714.99 g/mol |
| Exact Mass | 714.28 |
| IUPAC Name | 2,12-bis(3-ethyl-3-methoxypent-1-ynyl)-7-(4-propan-2-ylphenyl)sulfonyl-6-thiapentacyclo[11.8.0.03,11.05,9.015,20]henicosa-1(21),2,4,7,9,11,13,15,17,19-decaene |
| SMILES | CCC(C#Cc1c2cc3ccccc3cc2c(C#CC(CC)(CC)OC)c2cc3sc(S(=O)(=O)c4ccc(C(C)C)cc4)cc3cc12)(CC)OC |
| InChI | InChI=1S/C45H46O4S2/c1-9-44(10-2,48-7)23-21-36-38-25-32-15-13-14-16-33(32)26-39(38)37(22-24-45(11-3,12-4)49-8)41-29-42-34(27-40(36)41)28-43(50-42)51(46,47)35-19-17-31(18-20-35)30(5)6/h13-20,25-30H,9-12H2,1-8H3 |
| InChIKey | JCKCYDAPOUJFTD-UHFFFAOYSA-N |
| XLogP | 11.43 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.99 |
| LogP ≤ 5 | 11.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|