C50H63FO2S — CID 129120019
2,12-bis(3-tert-butyl-3-methoxy-4,4-dimethylpent-1-ynyl)-7-fluoro-16,19-di(propan-2-yl)-6-thiapentacyclo[11.8.0.03,11.05,9.015,20]henicosa-1(21),2,4,7,9,11,13,15,17,19-decaene (PubChem CID 129120019) has the molecular formula C50H63FO2S and a molecular weight of 747.12 g/mol. Its IUPAC name is 2,12-bis(3-tert-butyl-3-methoxy-4,4-dimethylpent-1-ynyl)-7-fluoro-16,19-di(propan-2-yl)-6-thiapentacyclo[11.8.0.03,11.05,9.015,20]henicosa-1(21),2,4,7,9,11,13,15,17,19-decaene.
| Compound Name | 2,12-bis(3-tert-butyl-3-methoxy-4,4-dimethylpent-1-ynyl)-7-fluoro-16,19-di(propan-2-yl)-6-thiapentacyclo[11.8.0.03,11.05,9.015,20]henicosa-1(21),2,4,7,9,11,13,15,17,19-decaene |
|---|---|
| PubChem CID | 129120019 |
| Molecular Formula | C50H63FO2S |
| Molecular Weight | 747.12 g/mol |
| Exact Mass | 746.45 |
| IUPAC Name | 2,12-bis(3-tert-butyl-3-methoxy-4,4-dimethylpent-1-ynyl)-7-fluoro-16,19-di(propan-2-yl)-6-thiapentacyclo[11.8.0.03,11.05,9.015,20]henicosa-1(21),2,4,7,9,11,13,15,17,19-decaene |
| SMILES | COC(C#Cc1c2cc3cc(F)sc3cc2c(C#CC(OC)(C(C)(C)C)C(C)(C)C)c2cc3c(C(C)C)ccc(C(C)C)c3cc12)(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C50H63FO2S/c1-30(2)33-19-20-34(31(3)4)39-28-41-36(22-24-50(53-18,47(11,12)13)48(14,15)16)42-29-43-32(26-44(51)54-43)25-37(42)35(40(41)27-38(33)39)21-23-49(52-17,45(5,6)7)46(8,9)10/h19-20,25-31H,1-18H3 |
| InChIKey | WPZQPDJIDOKMPI-UHFFFAOYSA-N |
| XLogP | 14.40 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.12 |
| LogP ≤ 5 | 14.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|