C16H22O — CID 10775834
3-(3-methoxy-3-methylbut-1-ynyl)-1,2,4,5-tetramethylbenzene (PubChem CID 10775834) has the molecular formula C16H22O and a molecular weight of 230.35 g/mol. Its IUPAC name is 3-(3-methoxy-3-methylbut-1-ynyl)-1,2,4,5-tetramethylbenzene.
| Compound Name | 3-(3-methoxy-3-methylbut-1-ynyl)-1,2,4,5-tetramethylbenzene |
|---|---|
| PubChem CID | 10775834 |
| Molecular Formula | C16H22O |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | 3-(3-methoxy-3-methylbut-1-ynyl)-1,2,4,5-tetramethylbenzene |
| SMILES | COC(C)(C)C#Cc1c(C)c(C)cc(C)c1C |
| InChI | InChI=1S/C16H22O/c1-11-10-12(2)14(4)15(13(11)3)8-9-16(5,6)17-7/h10H,1-7H3 |
| InChIKey | DFULHYHOYXFNGR-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|