C13H16S — CID 169487656
3-(2,3,5,6-tetramethylphenyl)prop-2-yne-1-thiol (PubChem CID 169487656) has the molecular formula C13H16S and a molecular weight of 204.34 g/mol. Its IUPAC name is 3-(2,3,5,6-tetramethylphenyl)prop-2-yne-1-thiol.
| Compound Name | 3-(2,3,5,6-tetramethylphenyl)prop-2-yne-1-thiol |
|---|---|
| PubChem CID | 169487656 |
| Molecular Formula | C13H16S |
| Molecular Weight | 204.34 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | 3-(2,3,5,6-tetramethylphenyl)prop-2-yne-1-thiol |
| SMILES | Cc1cc(C)c(C)c(C#CCS)c1C |
| InChI | InChI=1S/C13H16S/c1-9-8-10(2)12(4)13(11(9)3)6-5-7-14/h8,14H,7H2,1-4H3 |
| InChIKey | DITSSKGPDGBUMN-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.34 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|