C9H5BrF2S — CID 169487636
3-(4-bromo-2,6-difluorophenyl)prop-2-yne-1-thiol (PubChem CID 169487636) has the molecular formula C9H5BrF2S and a molecular weight of 263.11 g/mol. Its IUPAC name is 3-(4-bromo-2,6-difluorophenyl)prop-2-yne-1-thiol.
| Compound Name | 3-(4-bromo-2,6-difluorophenyl)prop-2-yne-1-thiol |
|---|---|
| PubChem CID | 169487636 |
| Molecular Formula | C9H5BrF2S |
| Molecular Weight | 263.11 g/mol |
| Exact Mass | 261.93 |
| IUPAC Name | 3-(4-bromo-2,6-difluorophenyl)prop-2-yne-1-thiol |
| SMILES | Fc1cc(Br)cc(F)c1C#CCS |
| InChI | InChI=1S/C9H5BrF2S/c10-6-4-8(11)7(2-1-3-13)9(12)5-6/h4-5,13H,3H2 |
| InChIKey | WCGVXTYAPXVRDL-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.11 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|