C10H6Br3F — CID 170467176
1,5-dibromo-2-(4-bromobut-1-ynyl)-3-fluorobenzene (PubChem CID 170467176) has the molecular formula C10H6Br3F and a molecular weight of 384.87 g/mol. Its IUPAC name is 1,5-dibromo-2-(4-bromobut-1-ynyl)-3-fluorobenzene.
| Compound Name | 1,5-dibromo-2-(4-bromobut-1-ynyl)-3-fluorobenzene |
|---|---|
| PubChem CID | 170467176 |
| Molecular Formula | C10H6Br3F |
| Molecular Weight | 384.87 g/mol |
| Exact Mass | 381.80 |
| IUPAC Name | 1,5-dibromo-2-(4-bromobut-1-ynyl)-3-fluorobenzene |
| SMILES | Fc1cc(Br)cc(Br)c1C#CCCBr |
| InChI | InChI=1S/C10H6Br3F/c11-4-2-1-3-8-9(13)5-7(12)6-10(8)14/h5-6H,2,4H2 |
| InChIKey | ZZFYKHZWJDCJKV-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.87 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|