C19H27Br — CID 170467088
2-(4-bromobut-1-ynyl)-1,3,5-tri(propan-2-yl)benzene (PubChem CID 170467088) has the molecular formula C19H27Br and a molecular weight of 335.33 g/mol. Its IUPAC name is 2-(4-bromobut-1-ynyl)-1,3,5-tri(propan-2-yl)benzene.
| Compound Name | 2-(4-bromobut-1-ynyl)-1,3,5-tri(propan-2-yl)benzene |
|---|---|
| PubChem CID | 170467088 |
| Molecular Formula | C19H27Br |
| Molecular Weight | 335.33 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 2-(4-bromobut-1-ynyl)-1,3,5-tri(propan-2-yl)benzene |
| SMILES | CC(C)c1cc(C(C)C)c(C#CCCBr)c(C(C)C)c1 |
| InChI | InChI=1S/C19H27Br/c1-13(2)16-11-18(14(3)4)17(9-7-8-10-20)19(12-16)15(5)6/h11-15H,8,10H2,1-6H3 |
| InChIKey | UVETVHABGKNBMG-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.33 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|