C16H21Cl — CID 60800049
1-(4-chlorobut-1-ynyl)-2,4-di(propan-2-yl)benzene (PubChem CID 60800049) has the molecular formula C16H21Cl and a molecular weight of 248.80 g/mol. Its IUPAC name is 1-(4-chlorobut-1-ynyl)-2,4-di(propan-2-yl)benzene.
| Compound Name | 1-(4-chlorobut-1-ynyl)-2,4-di(propan-2-yl)benzene |
|---|---|
| PubChem CID | 60800049 |
| Molecular Formula | C16H21Cl |
| Molecular Weight | 248.80 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 1-(4-chlorobut-1-ynyl)-2,4-di(propan-2-yl)benzene |
| SMILES | CC(C)c1ccc(C#CCCCl)c(C(C)C)c1 |
| InChI | InChI=1S/C16H21Cl/c1-12(2)15-9-8-14(7-5-6-10-17)16(11-15)13(3)4/h8-9,11-13H,6,10H2,1-4H3 |
| InChIKey | BKBHPDPIAGQGHF-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.80 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|