C32H27F3O6 — CID 56944404
7-[(7-methoxy-2-oxochromen-4-yl)methoxy]-8-(3-methylbutyl)-3-[4-(trifluoromethyl)phenyl]chromen-2-one (PubChem CID 56944404) has the molecular formula C32H27F3O6 and a molecular weight of 564.56 g/mol. Its IUPAC name is 7-[(7-methoxy-2-oxochromen-4-yl)methoxy]-8-(3-methylbutyl)-3-[4-(trifluoromethyl)phenyl]chromen-2-one.
| Compound Name | 7-[(7-methoxy-2-oxochromen-4-yl)methoxy]-8-(3-methylbutyl)-3-[4-(trifluoromethyl)phenyl]chromen-2-one |
|---|---|
| PubChem CID | 56944404 |
| Molecular Formula | C32H27F3O6 |
| Molecular Weight | 564.56 g/mol |
| Exact Mass | 564.18 |
| IUPAC Name | 7-[(7-methoxy-2-oxochromen-4-yl)methoxy]-8-(3-methylbutyl)-3-[4-(trifluoromethyl)phenyl]chromen-2-one |
| SMILES | COc1ccc2c(COc3ccc4cc(-c5ccc(C(F)(F)F)cc5)c(=O)oc4c3CCC(C)C)cc(=O)oc2c1 |
| InChI | InChI=1S/C32H27F3O6/c1-18(2)4-11-25-27(39-17-21-15-29(36)40-28-16-23(38-3)10-12-24(21)28)13-7-20-14-26(31(37)41-30(20)25)19-5-8-22(9-6-19)32(33,34)35/h5-10,12-16,18H,4,11,17H2,1-3H3 |
| InChIKey | VCLSIQRHLQNWFG-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 78.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.56 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|