C17H32BNO3Si — CID 56945596
(E)-6-[dimethyl(propan-2-yloxy)silyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hex-5-enenitrile (PubChem CID 56945596) has the molecular formula C17H32BNO3Si and a molecular weight of 337.35 g/mol. Its IUPAC name is (E)-6-[dimethyl(propan-2-yloxy)silyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hex-5-enenitrile.
| Compound Name | (E)-6-[dimethyl(propan-2-yloxy)silyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hex-5-enenitrile |
|---|---|
| PubChem CID | 56945596 |
| Molecular Formula | C17H32BNO3Si |
| Molecular Weight | 337.35 g/mol |
| Exact Mass | 337.22 |
| IUPAC Name | (E)-6-[dimethyl(propan-2-yloxy)silyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hex-5-enenitrile |
| SMILES | CC(C)O[Si](C)(C)/C=C(/CCCC#N)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C17H32BNO3Si/c1-14(2)20-23(7,8)13-15(11-9-10-12-19)18-21-16(3,4)17(5,6)22-18/h13-14H,9-11H2,1-8H3/b15-13- |
| InChIKey | XJQLRTWWZPVNEI-SQFISAMPSA-N |
| XLogP | 4.41 |
| TPSA | 51.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.35 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|