C14H25BNO3Si- — CID 102111315
4-(2,2,7,7,8,8-hexamethyl-1,6,9-trioxa-2-sila-5-boranuidaspiro[4.4]non-3-en-3-yl)butanenitrile (PubChem CID 102111315) has the molecular formula C14H25BNO3Si- and a molecular weight of 294.26 g/mol. Its IUPAC name is 4-(2,2,7,7,8,8-hexamethyl-1,6,9-trioxa-2-sila-5-boranuidaspiro[4.4]non-3-en-3-yl)butanenitrile.
| Compound Name | 4-(2,2,7,7,8,8-hexamethyl-1,6,9-trioxa-2-sila-5-boranuidaspiro[4.4]non-3-en-3-yl)butanenitrile |
|---|---|
| PubChem CID | 102111315 |
| Molecular Formula | C14H25BNO3Si- |
| Molecular Weight | 294.26 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 4-(2,2,7,7,8,8-hexamethyl-1,6,9-trioxa-2-sila-5-boranuidaspiro[4.4]non-3-en-3-yl)butanenitrile |
| SMILES | CC1(C)O[B-]2(C=C(CCCC#N)[Si](C)(C)O2)OC1(C)C |
| InChI | InChI=1S/C14H25BNO3Si/c1-13(2)14(3,4)18-15(17-13)11-12(9-7-8-10-16)20(5,6)19-15/h11H,7-9H2,1-6H3/q-1 |
| InChIKey | YEHWZGHGIXSFCV-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 51.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.26 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|