C14H25BClNO2Si — CID 135007772
(Z)-5-[chloro(dimethyl)silyl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hex-5-enenitrile (PubChem CID 135007772) has the molecular formula C14H25BClNO2Si and a molecular weight of 313.71 g/mol. Its IUPAC name is (Z)-5-[chloro(dimethyl)silyl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hex-5-enenitrile.
| Compound Name | (Z)-5-[chloro(dimethyl)silyl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hex-5-enenitrile |
|---|---|
| PubChem CID | 135007772 |
| Molecular Formula | C14H25BClNO2Si |
| Molecular Weight | 313.71 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | (Z)-5-[chloro(dimethyl)silyl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hex-5-enenitrile |
| SMILES | CC1(C)OB(/C=C(/CCCC#N)[Si](C)(C)Cl)OC1(C)C |
| InChI | InChI=1S/C14H25BClNO2Si/c1-13(2)14(3,4)19-15(18-13)11-12(20(5,6)16)9-7-8-10-17/h11H,7-9H2,1-6H3/b12-11- |
| InChIKey | FIUCRWJSFXPQNJ-QXMHVHEDSA-N |
| XLogP | 4.22 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.71 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|