C19H14O4 — CID 56946404
(E)-3-(3,4-dihydroxyphenyl)-1-(1-hydroxynaphthalen-2-yl)prop-2-en-1-one (PubChem CID 56946404) has the molecular formula C19H14O4 and a molecular weight of 306.32 g/mol. Its IUPAC name is (E)-3-(3,4-dihydroxyphenyl)-1-(1-hydroxynaphthalen-2-yl)prop-2-en-1-one.
| Compound Name | (E)-3-(3,4-dihydroxyphenyl)-1-(1-hydroxynaphthalen-2-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 56946404 |
| Molecular Formula | C19H14O4 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | (E)-3-(3,4-dihydroxyphenyl)-1-(1-hydroxynaphthalen-2-yl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(O)c(O)c1)c1ccc2ccccc2c1O |
| InChI | InChI=1S/C19H14O4/c20-16(9-5-12-6-10-17(21)18(22)11-12)15-8-7-13-3-1-2-4-14(13)19(15)23/h1-11,21-23H/b9-5+ |
| InChIKey | WVKAETXYCRETHP-WEVVVXLNSA-N |
| XLogP | 3.85 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|