C15H11BrO5 — CID 77136676
1-(2-bromo-4,5-dihydroxyphenyl)-3-(3,4-dihydroxyphenyl)prop-2-en-1-one (PubChem CID 77136676) has the molecular formula C15H11BrO5 and a molecular weight of 351.15 g/mol. Its IUPAC name is 1-(2-bromo-4,5-dihydroxyphenyl)-3-(3,4-dihydroxyphenyl)prop-2-en-1-one.
| Compound Name | 1-(2-bromo-4,5-dihydroxyphenyl)-3-(3,4-dihydroxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 77136676 |
| Molecular Formula | C15H11BrO5 |
| Molecular Weight | 351.15 g/mol |
| Exact Mass | 349.98 |
| IUPAC Name | 1-(2-bromo-4,5-dihydroxyphenyl)-3-(3,4-dihydroxyphenyl)prop-2-en-1-one |
| SMILES | O=C(C=Cc1ccc(O)c(O)c1)c1cc(O)c(O)cc1Br |
| InChI | InChI=1S/C15H11BrO5/c16-10-7-15(21)14(20)6-9(10)11(17)3-1-8-2-4-12(18)13(19)5-8/h1-7,18-21H |
| InChIKey | NWXOWSOFKLEYFC-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.15 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|