C19H15FN4O5 — CID 56946501
[(6S)-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-yl] N-[4-(4-fluorophenyl)phenyl]carbamate (PubChem CID 56946501) has the molecular formula C19H15FN4O5 and a molecular weight of 398.35 g/mol. Its IUPAC name is [(6S)-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-yl] N-[4-(4-fluorophenyl)phenyl]carbamate.
| Compound Name | [(6S)-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-yl] N-[4-(4-fluorophenyl)phenyl]carbamate |
|---|---|
| PubChem CID | 56946501 |
| Molecular Formula | C19H15FN4O5 |
| Molecular Weight | 398.35 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | [(6S)-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-6-yl] N-[4-(4-fluorophenyl)phenyl]carbamate |
| SMILES | O=C(Nc1ccc(-c2ccc(F)cc2)cc1)O[C@@H]1COc2nc([N+](=O)[O-])cn2C1 |
| InChI | InChI=1S/C19H15FN4O5/c20-14-5-1-12(2-6-14)13-3-7-15(8-4-13)21-19(25)29-16-9-23-10-17(24(26)27)22-18(23)28-11-16/h1-8,10,16H,9,11H2,(H,21,25)/t16-/m0/s1 |
| InChIKey | LCRNPQTYSMXYBX-INIZCTEOSA-N |
| XLogP | 3.61 |
| TPSA | 108.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.35 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|