C22H14ClF3N2 — CID 56946538
N-(4-chlorophenyl)-2,2,2-trifluoro-1-(2-phenylindol-1-yl)ethanimine (PubChem CID 56946538) has the molecular formula C22H14ClF3N2 and a molecular weight of 398.82 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2,2,2-trifluoro-1-(2-phenylindol-1-yl)ethanimine.
| Compound Name | N-(4-chlorophenyl)-2,2,2-trifluoro-1-(2-phenylindol-1-yl)ethanimine |
|---|---|
| PubChem CID | 56946538 |
| Molecular Formula | C22H14ClF3N2 |
| Molecular Weight | 398.82 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | N-(4-chlorophenyl)-2,2,2-trifluoro-1-(2-phenylindol-1-yl)ethanimine |
| SMILES | FC(F)(F)/C(=N\c1ccc(Cl)cc1)n1c(-c2ccccc2)cc2ccccc21 |
| InChI | InChI=1S/C22H14ClF3N2/c23-17-10-12-18(13-11-17)27-21(22(24,25)26)28-19-9-5-4-8-16(19)14-20(28)15-6-2-1-3-7-15/h1-14H/b27-21+ |
| InChIKey | AVDAZCOFYWLGOC-SZXQPVLSSA-N |
| XLogP | 7.10 |
| TPSA | 17.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.82 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|