C18H12ClF3N2O2 — CID 134116686
N-[5-chloro-2-(2-methylindole-1-carbonyl)phenyl]-2,2,2-trifluoroacetamide (PubChem CID 134116686) has the molecular formula C18H12ClF3N2O2 and a molecular weight of 380.75 g/mol. Its IUPAC name is N-[5-chloro-2-(2-methylindole-1-carbonyl)phenyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[5-chloro-2-(2-methylindole-1-carbonyl)phenyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 134116686 |
| Molecular Formula | C18H12ClF3N2O2 |
| Molecular Weight | 380.75 g/mol |
| Exact Mass | 380.05 |
| IUPAC Name | N-[5-chloro-2-(2-methylindole-1-carbonyl)phenyl]-2,2,2-trifluoroacetamide |
| SMILES | Cc1cc2ccccc2n1C(=O)c1ccc(Cl)cc1NC(=O)C(F)(F)F |
| InChI | InChI=1S/C18H12ClF3N2O2/c1-10-8-11-4-2-3-5-15(11)24(10)16(25)13-7-6-12(19)9-14(13)23-17(26)18(20,21)22/h2-9H,1H3,(H,23,26) |
| InChIKey | PRHNRRDMPGNLRE-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.75 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |