C26H34N6O2 — CID 56947811
(E)-2-cyano-N-[cyclobutyl-[3-[2-[2-(dimethylamino)ethyl-methylamino]ethoxy]phenyl]methyl]-3-pyrimidin-4-ylprop-2-enamide (PubChem CID 56947811) has the molecular formula C26H34N6O2 and a molecular weight of 462.60 g/mol. Its IUPAC name is (E)-2-cyano-N-[cyclobutyl-[3-[2-[2-(dimethylamino)ethyl-methylamino]ethoxy]phenyl]methyl]-3-pyrimidin-4-ylprop-2-enamide.
| Compound Name | (E)-2-cyano-N-[cyclobutyl-[3-[2-[2-(dimethylamino)ethyl-methylamino]ethoxy]phenyl]methyl]-3-pyrimidin-4-ylprop-2-enamide |
|---|---|
| PubChem CID | 56947811 |
| Molecular Formula | C26H34N6O2 |
| Molecular Weight | 462.60 g/mol |
| Exact Mass | 462.27 |
| IUPAC Name | (E)-2-cyano-N-[cyclobutyl-[3-[2-[2-(dimethylamino)ethyl-methylamino]ethoxy]phenyl]methyl]-3-pyrimidin-4-ylprop-2-enamide |
| SMILES | CN(C)CCN(C)CCOc1cccc(C(NC(=O)/C(C#N)=C/c2ccncn2)C2CCC2)c1 |
| InChI | InChI=1S/C26H34N6O2/c1-31(2)12-13-32(3)14-15-34-24-9-5-8-21(17-24)25(20-6-4-7-20)30-26(33)22(18-27)16-23-10-11-28-19-29-23/h5,8-11,16-17,19-20,25H,4,6-7,12-15H2,1-3H3,(H,30,33)/b22-16+ |
| InChIKey | OOCYSQSAFIJCCY-CJLVFECKSA-N |
| XLogP | 2.91 |
| TPSA | 94.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.60 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|