C21H28N4O3 — CID 134526838
(E)-2-cyano-N-[1-[4-[2-(dimethylamino)ethoxy]cyclohexa-1,3-dien-1-yl]butyl]-3-(1,2-oxazol-3-yl)prop-2-enamide (PubChem CID 134526838) has the molecular formula C21H28N4O3 and a molecular weight of 384.48 g/mol. Its IUPAC name is (E)-2-cyano-N-[1-[4-[2-(dimethylamino)ethoxy]cyclohexa-1,3-dien-1-yl]butyl]-3-(1,2-oxazol-3-yl)prop-2-enamide.
| Compound Name | (E)-2-cyano-N-[1-[4-[2-(dimethylamino)ethoxy]cyclohexa-1,3-dien-1-yl]butyl]-3-(1,2-oxazol-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 134526838 |
| Molecular Formula | C21H28N4O3 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | (E)-2-cyano-N-[1-[4-[2-(dimethylamino)ethoxy]cyclohexa-1,3-dien-1-yl]butyl]-3-(1,2-oxazol-3-yl)prop-2-enamide |
| SMILES | CCCC(NC(=O)/C(C#N)=C/c1ccon1)C1=CC=C(OCCN(C)C)CC1 |
| InChI | InChI=1S/C21H28N4O3/c1-4-5-20(16-6-8-19(9-7-16)27-13-11-25(2)3)23-21(26)17(15-22)14-18-10-12-28-24-18/h6,8,10,12,14,20H,4-5,7,9,11,13H2,1-3H3,(H,23,26)/b17-14+ |
| InChIKey | VNPPVORUANTHPI-SAPNQHFASA-N |
| XLogP | 3.05 |
| TPSA | 91.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|