C29H57NO — CID 56948276
(2S)-N,N-dimethyl-1-[(9Z,12Z)-octadeca-9,12-dienoxy]nonan-2-amine (PubChem CID 56948276) has the molecular formula C29H57NO and a molecular weight of 435.78 g/mol. Its IUPAC name is (2S)-N,N-dimethyl-1-[(9Z,12Z)-octadeca-9,12-dienoxy]nonan-2-amine.
| Compound Name | (2S)-N,N-dimethyl-1-[(9Z,12Z)-octadeca-9,12-dienoxy]nonan-2-amine |
|---|---|
| PubChem CID | 56948276 |
| Molecular Formula | C29H57NO |
| Molecular Weight | 435.78 g/mol |
| Exact Mass | 435.44 |
| IUPAC Name | (2S)-N,N-dimethyl-1-[(9Z,12Z)-octadeca-9,12-dienoxy]nonan-2-amine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCOC[C@H](CCCCCCC)N(C)C |
| InChI | InChI=1S/C29H57NO/c1-5-7-9-11-12-13-14-15-16-17-18-19-20-21-23-25-27-31-28-29(30(3)4)26-24-22-10-8-6-2/h12-13,15-16,29H,5-11,14,17-28H2,1-4H3/b13-12-,16-15-/t29-/m0/s1 |
| InChIKey | WOFGATJLOIZUMO-QYZAPVBRSA-N |
| XLogP | 9.11 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.78 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|