C17H20ClN5O — CID 56949460
2-[3-(1H-benzimidazol-2-yl)propoxy]-6-chloro-N-ethyl-5-methylpyrimidin-4-amine (PubChem CID 56949460) has the molecular formula C17H20ClN5O and a molecular weight of 345.83 g/mol. Its IUPAC name is 2-[3-(1H-benzimidazol-2-yl)propoxy]-6-chloro-N-ethyl-5-methylpyrimidin-4-amine.
| Compound Name | 2-[3-(1H-benzimidazol-2-yl)propoxy]-6-chloro-N-ethyl-5-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 56949460 |
| Molecular Formula | C17H20ClN5O |
| Molecular Weight | 345.83 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | 2-[3-(1H-benzimidazol-2-yl)propoxy]-6-chloro-N-ethyl-5-methylpyrimidin-4-amine |
| SMILES | CCNc1nc(OCCCc2nc3ccccc3[nH]2)nc(Cl)c1C |
| InChI | InChI=1S/C17H20ClN5O/c1-3-19-16-11(2)15(18)22-17(23-16)24-10-6-9-14-20-12-7-4-5-8-13(12)21-14/h4-5,7-8H,3,6,9-10H2,1-2H3,(H,20,21)(H,19,22,23) |
| InChIKey | CVBQOAKOWDJVQL-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.83 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|