C13H18BrNO2 — CID 56951921
1-(3-acetylpyridin-1-ium-1-yl)-3,3-dimethylbutan-2-one bromide (PubChem CID 56951921) has the molecular formula C13H18BrNO2 and a molecular weight of 300.20 g/mol. Its IUPAC name is 1-(3-acetylpyridin-1-ium-1-yl)-3,3-dimethylbutan-2-one bromide.
| Compound Name | 1-(3-acetylpyridin-1-ium-1-yl)-3,3-dimethylbutan-2-one bromide |
|---|---|
| PubChem CID | 56951921 |
| Molecular Formula | C13H18BrNO2 |
| Molecular Weight | 300.20 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | 1-(3-acetylpyridin-1-ium-1-yl)-3,3-dimethylbutan-2-one bromide |
| SMILES | CC(=O)c1ccc[n+](CC(=O)C(C)(C)C)c1.[Br-] |
| InChI | InChI=1S/C13H18NO2.BrH/c1-10(15)11-6-5-7-14(8-11)9-12(16)13(2,3)4;/h5-8H,9H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | ZVDMEWSDKNZOGI-UHFFFAOYSA-M |
| XLogP | -1.20 |
| TPSA | 38.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.20 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|