C16H19FO5 — CID 56955221
methyl 2-[(4-fluorophenyl)-[(2-methylpropan-2-yl)oxycarbonyloxy]methyl]prop-2-enoate (PubChem CID 56955221) has the molecular formula C16H19FO5 and a molecular weight of 310.32 g/mol. Its IUPAC name is methyl 2-[(4-fluorophenyl)-[(2-methylpropan-2-yl)oxycarbonyloxy]methyl]prop-2-enoate.
| Compound Name | methyl 2-[(4-fluorophenyl)-[(2-methylpropan-2-yl)oxycarbonyloxy]methyl]prop-2-enoate |
|---|---|
| PubChem CID | 56955221 |
| Molecular Formula | C16H19FO5 |
| Molecular Weight | 310.32 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | methyl 2-[(4-fluorophenyl)-[(2-methylpropan-2-yl)oxycarbonyloxy]methyl]prop-2-enoate |
| SMILES | C=C(C(=O)OC)C(OC(=O)OC(C)(C)C)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H19FO5/c1-10(14(18)20-5)13(11-6-8-12(17)9-7-11)21-15(19)22-16(2,3)4/h6-9,13H,1H2,2-5H3 |
| InChIKey | OXGYHWSSDLMQIG-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.32 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|