C27H20N2O — CID 56955721
(1E,4E)-1,5-bis(3-phenyl-2-pyridinyl)penta-1,4-dien-3-one (PubChem CID 56955721) has the molecular formula C27H20N2O and a molecular weight of 388.47 g/mol. Its IUPAC name is (1E,4E)-1,5-bis(3-phenyl-2-pyridinyl)penta-1,4-dien-3-one.
| Compound Name | (1E,4E)-1,5-bis(3-phenyl-2-pyridinyl)penta-1,4-dien-3-one |
|---|---|
| PubChem CID | 56955721 |
| Molecular Formula | C27H20N2O |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | (1E,4E)-1,5-bis(3-phenyl-2-pyridinyl)penta-1,4-dien-3-one |
| SMILES | O=C(/C=C/c1ncccc1-c1ccccc1)/C=C/c1ncccc1-c1ccccc1 |
| InChI | InChI=1S/C27H20N2O/c30-23(15-17-26-24(13-7-19-28-26)21-9-3-1-4-10-21)16-18-27-25(14-8-20-29-27)22-11-5-2-6-12-22/h1-20H/b17-15+,18-16+ |
| InChIKey | PTRMXXRJIJTWAZ-YTEMWHBBSA-N |
| XLogP | 6.11 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|