C19H12N2O — CID 56955722
(1E,4E)-1,5-bis(3-ethynyl-2-pyridinyl)penta-1,4-dien-3-one (PubChem CID 56955722) has the molecular formula C19H12N2O and a molecular weight of 284.32 g/mol. Its IUPAC name is (1E,4E)-1,5-bis(3-ethynyl-2-pyridinyl)penta-1,4-dien-3-one.
| Compound Name | (1E,4E)-1,5-bis(3-ethynyl-2-pyridinyl)penta-1,4-dien-3-one |
|---|---|
| PubChem CID | 56955722 |
| Molecular Formula | C19H12N2O |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | (1E,4E)-1,5-bis(3-ethynyl-2-pyridinyl)penta-1,4-dien-3-one |
| SMILES | C#Cc1cccnc1/C=C/C(=O)/C=C/c1ncccc1C#C |
| InChI | InChI=1S/C19H12N2O/c1-3-15-7-5-13-20-18(15)11-9-17(22)10-12-19-16(4-2)8-6-14-21-19/h1-2,5-14H/b11-9+,12-10+ |
| InChIKey | WMOJMQLVEIXVCO-WGDLNXRISA-N |
| XLogP | 2.73 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|