C11H9N3O — CID 569569
2-benzoyl-3,4-dihydropyrazole-5-carbonitrile (PubChem CID 569569) has the molecular formula C11H9N3O and a molecular weight of 199.21 g/mol. Its IUPAC name is 2-benzoyl-3,4-dihydropyrazole-5-carbonitrile.
| Compound Name | 2-benzoyl-3,4-dihydropyrazole-5-carbonitrile |
|---|---|
| PubChem CID | 569569 |
| Molecular Formula | C11H9N3O |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.07 |
| IUPAC Name | 2-benzoyl-3,4-dihydropyrazole-5-carbonitrile |
| SMILES | N#CC1=NN(C(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C11H9N3O/c12-8-10-6-7-14(13-10)11(15)9-4-2-1-3-5-9/h1-5H,6-7H2 |
| InChIKey | GGKHPJZERCQKQW-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 56.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |