C22H17ClN2OS — CID 136613216
[5-[4-(4-chlorophenyl)-2-sulfanylphenyl]-3,4-dihydropyrazol-2-yl]-phenylmethanone (PubChem CID 136613216) has the molecular formula C22H17ClN2OS and a molecular weight of 392.91 g/mol. Its IUPAC name is [5-[4-(4-chlorophenyl)-2-sulfanylphenyl]-3,4-dihydropyrazol-2-yl]-phenylmethanone.
| Compound Name | [5-[4-(4-chlorophenyl)-2-sulfanylphenyl]-3,4-dihydropyrazol-2-yl]-phenylmethanone |
|---|---|
| PubChem CID | 136613216 |
| Molecular Formula | C22H17ClN2OS |
| Molecular Weight | 392.91 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | [5-[4-(4-chlorophenyl)-2-sulfanylphenyl]-3,4-dihydropyrazol-2-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)N1CCC(c2ccc(-c3ccc(Cl)cc3)cc2S)=N1 |
| InChI | InChI=1S/C22H17ClN2OS/c23-18-9-6-15(7-10-18)17-8-11-19(21(27)14-17)20-12-13-25(24-20)22(26)16-4-2-1-3-5-16/h1-11,14,27H,12-13H2 |
| InChIKey | YDSNTOHAQPPPAP-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 32.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.91 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|