C18H13FN2O — CID 89350646
[5-(2-ethynylphenyl)-3,4-dihydropyrazol-2-yl]-(3-fluorophenyl)methanone (PubChem CID 89350646) has the molecular formula C18H13FN2O and a molecular weight of 292.31 g/mol. Its IUPAC name is [5-(2-ethynylphenyl)-3,4-dihydropyrazol-2-yl]-(3-fluorophenyl)methanone.
| Compound Name | [5-(2-ethynylphenyl)-3,4-dihydropyrazol-2-yl]-(3-fluorophenyl)methanone |
|---|---|
| PubChem CID | 89350646 |
| Molecular Formula | C18H13FN2O |
| Molecular Weight | 292.31 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | [5-(2-ethynylphenyl)-3,4-dihydropyrazol-2-yl]-(3-fluorophenyl)methanone |
| SMILES | C#Cc1ccccc1C1=NN(C(=O)c2cccc(F)c2)CC1 |
| InChI | InChI=1S/C18H13FN2O/c1-2-13-6-3-4-9-16(13)17-10-11-21(20-17)18(22)14-7-5-8-15(19)12-14/h1,3-9,12H,10-11H2 |
| InChIKey | OQKUTCIWELXBPW-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.31 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|