C16H20O8 — CID 56959376
(Z)-3-(3-methylphenyl)-2-[(2R,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyprop-2-enoic acid (PubChem CID 56959376) has the molecular formula C16H20O8 and a molecular weight of 340.33 g/mol. Its IUPAC name is (Z)-3-(3-methylphenyl)-2-[(2R,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyprop-2-enoic acid.
| Compound Name | (Z)-3-(3-methylphenyl)-2-[(2R,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyprop-2-enoic acid |
|---|---|
| PubChem CID | 56959376 |
| Molecular Formula | C16H20O8 |
| Molecular Weight | 340.33 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | (Z)-3-(3-methylphenyl)-2-[(2R,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyprop-2-enoic acid |
| SMILES | Cc1cccc(/C=C(\O[C@H]2O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]2O)C(=O)O)c1 |
| InChI | InChI=1S/C16H20O8/c1-8-3-2-4-9(5-8)6-10(15(21)22)23-16-14(20)13(19)12(18)11(7-17)24-16/h2-6,11-14,16-20H,7H2,1H3,(H,21,22)/b10-6-/t11-,12-,13+,14-,16-/m0/s1 |
| InChIKey | NMPYYTUHIFEHKX-NGCHCYCOSA-N |
| XLogP | -0.76 |
| TPSA | 136.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.33 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|