C15H17NO10 — CID 66980278
(E)-3-(2-nitrophenyl)-2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyprop-2-enoic acid (PubChem CID 66980278) has the molecular formula C15H17NO10 and a molecular weight of 371.30 g/mol. Its IUPAC name is (E)-3-(2-nitrophenyl)-2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyprop-2-enoic acid.
| Compound Name | (E)-3-(2-nitrophenyl)-2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyprop-2-enoic acid |
|---|---|
| PubChem CID | 66980278 |
| Molecular Formula | C15H17NO10 |
| Molecular Weight | 371.30 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | (E)-3-(2-nitrophenyl)-2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyprop-2-enoic acid |
| SMILES | O=C(O)/C(=C\c1ccccc1[N+](=O)[O-])OC1OC(CO)C(O)C(O)C1O |
| InChI | InChI=1S/C15H17NO10/c17-6-10-11(18)12(19)13(20)15(26-10)25-9(14(21)22)5-7-3-1-2-4-8(7)16(23)24/h1-5,10-13,15,17-20H,6H2,(H,21,22)/b9-5+ |
| InChIKey | HTDJSSDRXVLBFA-WEVVVXLNSA-N |
| XLogP | -1.16 |
| TPSA | 179.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.30 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|