C16H19BrO6 — CID 163437827
(Z)-3-(2-bromophenyl)-2-[(2R,4S,5S,6S)-5-hydroxy-6-(hydroxymethyl)-4-methyloxan-2-yl]oxyprop-2-enoic acid (PubChem CID 163437827) has the molecular formula C16H19BrO6 and a molecular weight of 387.23 g/mol. Its IUPAC name is (Z)-3-(2-bromophenyl)-2-[(2R,4S,5S,6S)-5-hydroxy-6-(hydroxymethyl)-4-methyloxan-2-yl]oxyprop-2-enoic acid.
| Compound Name | (Z)-3-(2-bromophenyl)-2-[(2R,4S,5S,6S)-5-hydroxy-6-(hydroxymethyl)-4-methyloxan-2-yl]oxyprop-2-enoic acid |
|---|---|
| PubChem CID | 163437827 |
| Molecular Formula | C16H19BrO6 |
| Molecular Weight | 387.23 g/mol |
| Exact Mass | 386.04 |
| IUPAC Name | (Z)-3-(2-bromophenyl)-2-[(2R,4S,5S,6S)-5-hydroxy-6-(hydroxymethyl)-4-methyloxan-2-yl]oxyprop-2-enoic acid |
| SMILES | C[C@H]1C[C@@H](O/C(=C\c2ccccc2Br)C(=O)O)O[C@@H](CO)[C@H]1O |
| InChI | InChI=1S/C16H19BrO6/c1-9-6-14(23-13(8-18)15(9)19)22-12(16(20)21)7-10-4-2-3-5-11(10)17/h2-5,7,9,13-15,18-19H,6,8H2,1H3,(H,20,21)/b12-7-/t9-,13-,14-,15-/m0/s1 |
| InChIKey | AVZQGOSDRCFONK-OUORZGDASA-N |
| XLogP | 2.00 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.23 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|