C34H47N3 — CID 56961143
N-butyl-7-ethyl-3,3,8,8,10-pentamethyl-7,21-diazahexacyclo[15.7.1.02,15.04,13.06,11.021,25]pentacosa-1(25),2(15),4(13),5,11,16-hexaen-14-imine (PubChem CID 56961143) has the molecular formula C34H47N3 and a molecular weight of 497.77 g/mol. Its IUPAC name is N-butyl-7-ethyl-3,3,8,8,10-pentamethyl-7,21-diazahexacyclo[15.7.1.02,15.04,13.06,11.021,25]pentacosa-1(25),2(15),4(13),5,11,16-hexaen-14-imine.
| Compound Name | N-butyl-7-ethyl-3,3,8,8,10-pentamethyl-7,21-diazahexacyclo[15.7.1.02,15.04,13.06,11.021,25]pentacosa-1(25),2(15),4(13),5,11,16-hexaen-14-imine |
|---|---|
| PubChem CID | 56961143 |
| Molecular Formula | C34H47N3 |
| Molecular Weight | 497.77 g/mol |
| Exact Mass | 497.38 |
| IUPAC Name | N-butyl-7-ethyl-3,3,8,8,10-pentamethyl-7,21-diazahexacyclo[15.7.1.02,15.04,13.06,11.021,25]pentacosa-1(25),2(15),4(13),5,11,16-hexaen-14-imine |
| SMILES | CCCC/N=C1\c2cc3c(cc2C(C)(C)c2c1cc1c4c2CCCN4CCC1)N(CC)C(C)(C)CC3C |
| InChI | InChI=1S/C34H47N3/c1-8-10-15-35-31-26-19-25-22(3)21-33(4,5)37(9-2)29(25)20-28(26)34(6,7)30-24-14-12-17-36-16-11-13-23(32(24)36)18-27(30)31/h18-20,22H,8-17,21H2,1-7H3/b35-31+ |
| InChIKey | RPYRROYFZAAZIW-JSLDZMDGSA-N |
| XLogP | 7.77 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.77 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|