C42H52N3O3+ — CID 153280605
4-[[2-(7-ethyl-3,3,8,8,10-pentamethyl-7-aza-21-azoniahexacyclo[15.7.1.02,15.04,13.06,11.021,25]pentacosa-1,4(13),5,11,14,16,21(25)-heptaen-14-yl)benzoyl]-methylamino]butanoic acid (PubChem CID 153280605) has the molecular formula C42H52N3O3+ and a molecular weight of 646.90 g/mol. Its IUPAC name is 4-[[2-(7-ethyl-3,3,8,8,10-pentamethyl-7-aza-21-azoniahexacyclo[15.7.1.02,15.04,13.06,11.021,25]pentacosa-1,4(13),5,11,14,16,21(25)-heptaen-14-yl)benzoyl]-methylamino]butanoic acid.
| Compound Name | 4-[[2-(7-ethyl-3,3,8,8,10-pentamethyl-7-aza-21-azoniahexacyclo[15.7.1.02,15.04,13.06,11.021,25]pentacosa-1,4(13),5,11,14,16,21(25)-heptaen-14-yl)benzoyl]-methylamino]butanoic acid |
|---|---|
| PubChem CID | 153280605 |
| Molecular Formula | C42H52N3O3+ |
| Molecular Weight | 646.90 g/mol |
| Exact Mass | 646.40 |
| IUPAC Name | 4-[[2-(7-ethyl-3,3,8,8,10-pentamethyl-7-aza-21-azoniahexacyclo[15.7.1.02,15.04,13.06,11.021,25]pentacosa-1,4(13),5,11,14,16,21(25)-heptaen-14-yl)benzoyl]-methylamino]butanoic acid |
| SMILES | CCN1c2cc3c(cc2C(C)CC1(C)C)C(c1ccccc1C(=O)N(C)CCCC(=O)O)=c1cc2c4c(c1C3(C)C)CCC[N+]=4CCC2 |
| InChI | InChI=1S/C42H51N3O3/c1-8-45-35-24-34-32(23-31(35)26(2)25-41(45,3)4)37(28-15-9-10-16-29(28)40(48)43(7)19-13-18-36(46)47)33-22-27-14-11-20-44-21-12-17-30(39(27)44)38(33)42(34,5)6/h9-10,15-16,22-24,26H,8,11-14,17-21,25H2,1-7H3/p+1 |
| InChIKey | JKTIBBHMILXFRY-UHFFFAOYSA-O |
| XLogP | 6.01 |
| TPSA | 63.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.90 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|