C23H27ClN2O2 — CID 50861403
3-[(7-chloro-1-ethyl-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)methylideneamino]-2-methylbenzoic acid (PubChem CID 50861403) has the molecular formula C23H27ClN2O2 and a molecular weight of 398.93 g/mol. Its IUPAC name is 3-[(7-chloro-1-ethyl-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)methylideneamino]-2-methylbenzoic acid.
| Compound Name | 3-[(7-chloro-1-ethyl-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)methylideneamino]-2-methylbenzoic acid |
|---|---|
| PubChem CID | 50861403 |
| Molecular Formula | C23H27ClN2O2 |
| Molecular Weight | 398.93 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | 3-[(7-chloro-1-ethyl-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)methylideneamino]-2-methylbenzoic acid |
| SMILES | CCN1c2cc(Cl)c(/C=N/c3cccc(C(=O)O)c3C)cc2C(C)CC1(C)C |
| InChI | InChI=1S/C23H27ClN2O2/c1-6-26-21-11-19(24)16(10-18(21)14(2)12-23(26,4)5)13-25-20-9-7-8-17(15(20)3)22(27)28/h7-11,13-14H,6,12H2,1-5H3,(H,27,28)/b25-13+ |
| InChIKey | UFKFTJDCAUAVPW-DHRITJCHSA-N |
| XLogP | 6.21 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.93 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|