C22H26ClIN2 — CID 50861198
1-(7-chloro-1-ethyl-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)-N-(4-iodo-3-methylphenyl)methanimine (PubChem CID 50861198) has the molecular formula C22H26ClIN2 and a molecular weight of 480.82 g/mol. Its IUPAC name is 1-(7-chloro-1-ethyl-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)-N-(4-iodo-3-methylphenyl)methanimine.
| Compound Name | 1-(7-chloro-1-ethyl-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)-N-(4-iodo-3-methylphenyl)methanimine |
|---|---|
| PubChem CID | 50861198 |
| Molecular Formula | C22H26ClIN2 |
| Molecular Weight | 480.82 g/mol |
| Exact Mass | 480.08 |
| IUPAC Name | 1-(7-chloro-1-ethyl-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)-N-(4-iodo-3-methylphenyl)methanimine |
| SMILES | CCN1c2cc(Cl)c(/C=N/c3ccc(I)c(C)c3)cc2C(C)CC1(C)C |
| InChI | InChI=1S/C22H26ClIN2/c1-6-26-21-11-19(23)16(10-18(21)15(3)12-22(26,4)5)13-25-17-7-8-20(24)14(2)9-17/h7-11,13,15H,6,12H2,1-5H3/b25-13+ |
| InChIKey | KIIXHQXJHRJWTE-DHRITJCHSA-N |
| XLogP | 7.12 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.82 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|