C20H16ClN3O4S — CID 56964529
N-[2-chloro-3-(2-cyano-1-hydroxyprop-2-enyl)-7-phenoxyquinolin-6-yl]methanesulfonamide (PubChem CID 56964529) has the molecular formula C20H16ClN3O4S and a molecular weight of 429.89 g/mol. Its IUPAC name is N-[2-chloro-3-(2-cyano-1-hydroxyprop-2-enyl)-7-phenoxyquinolin-6-yl]methanesulfonamide.
| Compound Name | N-[2-chloro-3-(2-cyano-1-hydroxyprop-2-enyl)-7-phenoxyquinolin-6-yl]methanesulfonamide |
|---|---|
| PubChem CID | 56964529 |
| Molecular Formula | C20H16ClN3O4S |
| Molecular Weight | 429.89 g/mol |
| Exact Mass | 429.06 |
| IUPAC Name | N-[2-chloro-3-(2-cyano-1-hydroxyprop-2-enyl)-7-phenoxyquinolin-6-yl]methanesulfonamide |
| SMILES | C=C(C#N)C(O)c1cc2cc(NS(C)(=O)=O)c(Oc3ccccc3)cc2nc1Cl |
| InChI | InChI=1S/C20H16ClN3O4S/c1-12(11-22)19(25)15-8-13-9-17(24-29(2,26)27)18(10-16(13)23-20(15)21)28-14-6-4-3-5-7-14/h3-10,19,24-25H,1H2,2H3 |
| InChIKey | MYCHJDGECWAWFA-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 112.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.89 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|