C15H15NO4S — CID 13069209
N-(6-phenoxy-1,3-dihydro-2-benzofuran-5-yl)methanesulfonamide (PubChem CID 13069209) has the molecular formula C15H15NO4S and a molecular weight of 305.35 g/mol. Its IUPAC name is N-(6-phenoxy-1,3-dihydro-2-benzofuran-5-yl)methanesulfonamide.
| Compound Name | N-(6-phenoxy-1,3-dihydro-2-benzofuran-5-yl)methanesulfonamide |
|---|---|
| PubChem CID | 13069209 |
| Molecular Formula | C15H15NO4S |
| Molecular Weight | 305.35 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | N-(6-phenoxy-1,3-dihydro-2-benzofuran-5-yl)methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1cc2c(cc1Oc1ccccc1)COC2 |
| InChI | InChI=1S/C15H15NO4S/c1-21(17,18)16-14-7-11-9-19-10-12(11)8-15(14)20-13-5-3-2-4-6-13/h2-8,16H,9-10H2,1H3 |
| InChIKey | XWFMAJSSUPYWHT-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.35 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |