C17H14N2O7S — CID 54734204
N-[4-hydroxy-7-(methanesulfonamido)-2-oxo-6-phenoxychromen-3-yl]formamide (PubChem CID 54734204) has the molecular formula C17H14N2O7S and a molecular weight of 390.37 g/mol. Its IUPAC name is N-[4-hydroxy-7-(methanesulfonamido)-2-oxo-6-phenoxychromen-3-yl]formamide.
| Compound Name | N-[4-hydroxy-7-(methanesulfonamido)-2-oxo-6-phenoxychromen-3-yl]formamide |
|---|---|
| PubChem CID | 54734204 |
| Molecular Formula | C17H14N2O7S |
| Molecular Weight | 390.37 g/mol |
| Exact Mass | 390.05 |
| IUPAC Name | N-[4-hydroxy-7-(methanesulfonamido)-2-oxo-6-phenoxychromen-3-yl]formamide |
| SMILES | CS(=O)(=O)Nc1cc2oc(=O)c(NC=O)c(O)c2cc1Oc1ccccc1 |
| InChI | InChI=1S/C17H14N2O7S/c1-27(23,24)19-12-8-13-11(16(21)15(18-9-20)17(22)26-13)7-14(12)25-10-5-3-2-4-6-10/h2-9,19,21H,1H3,(H,18,20) |
| InChIKey | HHWXSBCNJLDTLC-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 134.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.37 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|