C16H16INO3S — CID 70540924
N-(1-iodo-6-phenoxy-2,3-dihydro-1H-inden-5-yl)methanesulfonamide (PubChem CID 70540924) has the molecular formula C16H16INO3S and a molecular weight of 429.28 g/mol. Its IUPAC name is N-(1-iodo-6-phenoxy-2,3-dihydro-1H-inden-5-yl)methanesulfonamide.
| Compound Name | N-(1-iodo-6-phenoxy-2,3-dihydro-1H-inden-5-yl)methanesulfonamide |
|---|---|
| PubChem CID | 70540924 |
| Molecular Formula | C16H16INO3S |
| Molecular Weight | 429.28 g/mol |
| Exact Mass | 428.99 |
| IUPAC Name | N-(1-iodo-6-phenoxy-2,3-dihydro-1H-inden-5-yl)methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1cc2c(cc1Oc1ccccc1)C(I)CC2 |
| InChI | InChI=1S/C16H16INO3S/c1-22(19,20)18-15-9-11-7-8-14(17)13(11)10-16(15)21-12-5-3-2-4-6-12/h2-6,9-10,14,18H,7-8H2,1H3 |
| InChIKey | VIDWSFCRROVBGA-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.28 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|