About N-[6-(3-methylphenoxy)-2,3-dihydro-1H-inden-5-yl]methanesulfonamide
N-[6-(3-methylphenoxy)-2,3-dihydro-1H-inden-5-yl]methanesulfonamide (PubChem CID 57195670) has the molecular formula C17H19NO3S
and a molecular weight of 317.41 g/mol. Its IUPAC name is N-[6-(3-methylphenoxy)-2,3-dihydro-1H-inden-5-yl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[6-(3-methylphenoxy)-2,3-dihydro-1H-inden-5-yl]methanesulfonamide |
| PubChem CID | 57195670 |
| Molecular Formula | C17H19NO3S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | N-[6-(3-methylphenoxy)-2,3-dihydro-1H-inden-5-yl]methanesulfonamide |
| SMILES | Cc1cccc(Oc2cc3c(cc2NS(C)(=O)=O)CCC3)c1 |
| InChI | InChI=1S/C17H19NO3S/c1-12-5-3-8-15(9-12)21-17-11-14-7-4-6-13(14)10-16(17)18-22(2,19)20/h3,5,8-11,18H,4,6-7H2,1-2H3 |
| InChIKey | GBKFPLIJRBZUFM-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[6-(3-methylphenoxy)-2,3-dihydro-1H-inden-5-yl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[6-(3-methylphenoxy)-2,3-dihydro-1H-inden-5-yl]methanesulfonamide?
The IUPAC name of N-[6-(3-methylphenoxy)-2,3-dihydro-1H-inden-5-yl]methanesulfonamide (CID 57195670) is N-[6-(3-methylphenoxy)-2,3-dihydro-1H-inden-5-yl]methanesulfonamide.
What is the SMILES notation for N-[6-(3-methylphenoxy)-2,3-dihydro-1H-inden-5-yl]methanesulfonamide?
The canonical SMILES for N-[6-(3-methylphenoxy)-2,3-dihydro-1H-inden-5-yl]methanesulfonamide is Cc1cccc(Oc2cc3c(cc2NS(C)(=O)=O)CCC3)c1.
What is the InChIKey of N-[6-(3-methylphenoxy)-2,3-dihydro-1H-inden-5-yl]methanesulfonamide?
The InChIKey is GBKFPLIJRBZUFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19NO3S/c1-12-5-3-8-15(9-12)21-17-11-14-7-4-6-13(14)10-16(17)18-22(2,19)20/h3,5,8-11,18H,4,6-7H2,1-2H3.
What are the key properties of N-[6-(3-methylphenoxy)-2,3-dihydro-1H-inden-5-yl]methanesulfonamide?
N-[6-(3-methylphenoxy)-2,3-dihydro-1H-inden-5-yl]methanesulfonamide has a molecular weight of 317.41 g/mol, XLogP of 3.65, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[6-(3-methylphenoxy)-2,3-dihydro-1H-inden-5-yl]methanesulfonamide is sourced from PubChem (CID 57195670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).