About N-[2-(3,4-dimethoxyphenyl)-3-hydroxy-4-oxo-6-phenoxychromen-7-yl]methanesulfonamide
N-[2-(3,4-dimethoxyphenyl)-3-hydroxy-4-oxo-6-phenoxychromen-7-yl]methanesulfonamide (PubChem CID 14722413) has the molecular formula C24H21NO8S
and a molecular weight of 483.50 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)-3-hydroxy-4-oxo-6-phenoxychromen-7-yl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[2-(3,4-dimethoxyphenyl)-3-hydroxy-4-oxo-6-phenoxychromen-7-yl]methanesulfonamide |
| PubChem CID | 14722413 |
| Molecular Formula | C24H21NO8S |
| Molecular Weight | 483.50 g/mol |
| Exact Mass | 483.10 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)-3-hydroxy-4-oxo-6-phenoxychromen-7-yl]methanesulfonamide |
| SMILES | COc1ccc(-c2oc3cc(NS(C)(=O)=O)c(Oc4ccccc4)cc3c(=O)c2O)cc1OC |
| InChI | InChI=1S/C24H21NO8S/c1-30-18-10-9-14(11-21(18)31-2)24-23(27)22(26)16-12-20(32-15-7-5-4-6-8-15)17(13-19(16)33-24)25-34(3,28)29/h4-13,25,27H,1-3H3 |
| InChIKey | FYORFJVLZXLRON-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 124.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 483.50 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze N-[2-(3,4-dimethoxyphenyl)-3-hydroxy-4-oxo-6-phenoxychromen-7-yl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(3,4-dimethoxyphenyl)-3-hydroxy-4-oxo-6-phenoxychromen-7-yl]methanesulfonamide?
The IUPAC name of N-[2-(3,4-dimethoxyphenyl)-3-hydroxy-4-oxo-6-phenoxychromen-7-yl]methanesulfonamide (CID 14722413) is N-[2-(3,4-dimethoxyphenyl)-3-hydroxy-4-oxo-6-phenoxychromen-7-yl]methanesulfonamide.
What is the SMILES notation for N-[2-(3,4-dimethoxyphenyl)-3-hydroxy-4-oxo-6-phenoxychromen-7-yl]methanesulfonamide?
The canonical SMILES for N-[2-(3,4-dimethoxyphenyl)-3-hydroxy-4-oxo-6-phenoxychromen-7-yl]methanesulfonamide is COc1ccc(-c2oc3cc(NS(C)(=O)=O)c(Oc4ccccc4)cc3c(=O)c2O)cc1OC.
What is the InChIKey of N-[2-(3,4-dimethoxyphenyl)-3-hydroxy-4-oxo-6-phenoxychromen-7-yl]methanesulfonamide?
The InChIKey is FYORFJVLZXLRON-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H21NO8S/c1-30-18-10-9-14(11-21(18)31-2)24-23(27)22(26)16-12-20(32-15-7-5-4-6-8-15)17(13-19(16)33-24)25-34(3,28)29/h4-13,25,27H,1-3H3.
What are the key properties of N-[2-(3,4-dimethoxyphenyl)-3-hydroxy-4-oxo-6-phenoxychromen-7-yl]methanesulfonamide?
N-[2-(3,4-dimethoxyphenyl)-3-hydroxy-4-oxo-6-phenoxychromen-7-yl]methanesulfonamide has a molecular weight of 483.50 g/mol, XLogP of 4.35, 7 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(3,4-dimethoxyphenyl)-3-hydroxy-4-oxo-6-phenoxychromen-7-yl]methanesulfonamide is sourced from PubChem (CID 14722413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).