C21H19ClN2O6S — CID 56964528
methyl 2-[[2-chloro-6-(methanesulfonamido)-7-phenoxyquinolin-3-yl]-hydroxymethyl]prop-2-enoate (PubChem CID 56964528) has the molecular formula C21H19ClN2O6S and a molecular weight of 462.91 g/mol. Its IUPAC name is methyl 2-[[2-chloro-6-(methanesulfonamido)-7-phenoxyquinolin-3-yl]-hydroxymethyl]prop-2-enoate.
| Compound Name | methyl 2-[[2-chloro-6-(methanesulfonamido)-7-phenoxyquinolin-3-yl]-hydroxymethyl]prop-2-enoate |
|---|---|
| PubChem CID | 56964528 |
| Molecular Formula | C21H19ClN2O6S |
| Molecular Weight | 462.91 g/mol |
| Exact Mass | 462.07 |
| IUPAC Name | methyl 2-[[2-chloro-6-(methanesulfonamido)-7-phenoxyquinolin-3-yl]-hydroxymethyl]prop-2-enoate |
| SMILES | C=C(C(=O)OC)C(O)c1cc2cc(NS(C)(=O)=O)c(Oc3ccccc3)cc2nc1Cl |
| InChI | InChI=1S/C21H19ClN2O6S/c1-12(21(26)29-2)19(25)15-9-13-10-17(24-31(3,27)28)18(11-16(13)23-20(15)22)30-14-7-5-4-6-8-14/h4-11,19,24-25H,1H2,2-3H3 |
| InChIKey | DRKWLVWLBJPGAN-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 114.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.91 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|