C17H23N3O — CID 56967494
(E,5R)-5-amino-6-(1H-indol-3-yl)-N,2,2-trimethylhex-3-enamide (PubChem CID 56967494) has the molecular formula C17H23N3O and a molecular weight of 285.39 g/mol. Its IUPAC name is (E,5R)-5-amino-6-(1H-indol-3-yl)-N,2,2-trimethylhex-3-enamide.
| Compound Name | (E,5R)-5-amino-6-(1H-indol-3-yl)-N,2,2-trimethylhex-3-enamide |
|---|---|
| PubChem CID | 56967494 |
| Molecular Formula | C17H23N3O |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | (E,5R)-5-amino-6-(1H-indol-3-yl)-N,2,2-trimethylhex-3-enamide |
| SMILES | CNC(=O)C(C)(C)/C=C/[C@H](N)Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C17H23N3O/c1-17(2,16(21)19-3)9-8-13(18)10-12-11-20-15-7-5-4-6-14(12)15/h4-9,11,13,20H,10,18H2,1-3H3,(H,19,21)/b9-8+/t13-/m0/s1 |
| InChIKey | UDXFFXSBGWRFIE-XEHSLEBBSA-N |
| XLogP | 2.37 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|