C16H20N2O3 — CID 150021228
5-amino-4-hydroxy-6-(1H-indol-3-yl)-2,2-dimethylhex-3-enoic acid (PubChem CID 150021228) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is 5-amino-4-hydroxy-6-(1H-indol-3-yl)-2,2-dimethylhex-3-enoic acid.
| Compound Name | 5-amino-4-hydroxy-6-(1H-indol-3-yl)-2,2-dimethylhex-3-enoic acid |
|---|---|
| PubChem CID | 150021228 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 5-amino-4-hydroxy-6-(1H-indol-3-yl)-2,2-dimethylhex-3-enoic acid |
| SMILES | CC(C)(C=C(O)C(N)Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C16H20N2O3/c1-16(2,15(20)21)8-14(19)12(17)7-10-9-18-13-6-4-3-5-11(10)13/h3-6,8-9,12,18-19H,7,17H2,1-2H3,(H,20,21) |
| InChIKey | DFHISNUNWMDSNN-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 99.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|