C26H25N7O2S — CID 56973869
N-[5-ethyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,3,4-thiadiazolidin-2-ylidene]-2-methoxybenzamide (PubChem CID 56973869) has the molecular formula C26H25N7O2S and a molecular weight of 499.60 g/mol. Its IUPAC name is N-[5-ethyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,3,4-thiadiazolidin-2-ylidene]-2-methoxybenzamide.
| Compound Name | N-[5-ethyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,3,4-thiadiazolidin-2-ylidene]-2-methoxybenzamide |
|---|---|
| PubChem CID | 56973869 |
| Molecular Formula | C26H25N7O2S |
| Molecular Weight | 499.60 g/mol |
| Exact Mass | 499.18 |
| IUPAC Name | N-[5-ethyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,3,4-thiadiazolidin-2-ylidene]-2-methoxybenzamide |
| SMILES | CCC1NN(Cc2ccc(-c3ccccc3-c3nn[nH]n3)cc2)/C(=N/C(=O)c2ccccc2OC)S1 |
| InChI | InChI=1S/C26H25N7O2S/c1-3-23-30-33(26(36-23)27-25(34)21-10-6-7-11-22(21)35-2)16-17-12-14-18(15-13-17)19-8-4-5-9-20(19)24-28-31-32-29-24/h4-15,23,30H,3,16H2,1-2H3,(H,28,29,31,32)/b27-26- |
| InChIKey | AQCPNWYUFZKNHB-RQZHXJHFSA-N |
| XLogP | 4.53 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.60 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|