C23H29N7S2 — CID 57265404
5-ethylsulfanyl-N-pentyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,3,4-thiadiazolidin-2-imine (PubChem CID 57265404) has the molecular formula C23H29N7S2 and a molecular weight of 467.67 g/mol. Its IUPAC name is 5-ethylsulfanyl-N-pentyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,3,4-thiadiazolidin-2-imine.
| Compound Name | 5-ethylsulfanyl-N-pentyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,3,4-thiadiazolidin-2-imine |
|---|---|
| PubChem CID | 57265404 |
| Molecular Formula | C23H29N7S2 |
| Molecular Weight | 467.67 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | 5-ethylsulfanyl-N-pentyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,3,4-thiadiazolidin-2-imine |
| SMILES | CCCCC/N=C1\SC(SCC)NN1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C23H29N7S2/c1-3-5-8-15-24-22-30(27-23(32-22)31-4-2)16-17-11-13-18(14-12-17)19-9-6-7-10-20(19)21-25-28-29-26-21/h6-7,9-14,23,27H,3-5,8,15-16H2,1-2H3,(H,25,26,28,29)/b24-22- |
| InChIKey | IVCPAOREHAVIJJ-GYHWCHFESA-N |
| XLogP | 5.17 |
| TPSA | 82.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.67 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|