C22H25N7O2S — CID 57151377
2-ethoxy-N-[5-ethyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,3,4-thiadiazolidin-2-ylidene]acetamide (PubChem CID 57151377) has the molecular formula C22H25N7O2S and a molecular weight of 451.56 g/mol. Its IUPAC name is 2-ethoxy-N-[5-ethyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,3,4-thiadiazolidin-2-ylidene]acetamide.
| Compound Name | 2-ethoxy-N-[5-ethyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,3,4-thiadiazolidin-2-ylidene]acetamide |
|---|---|
| PubChem CID | 57151377 |
| Molecular Formula | C22H25N7O2S |
| Molecular Weight | 451.56 g/mol |
| Exact Mass | 451.18 |
| IUPAC Name | 2-ethoxy-N-[5-ethyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,3,4-thiadiazolidin-2-ylidene]acetamide |
| SMILES | CCOCC(=O)/N=C1\SC(CC)NN1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C22H25N7O2S/c1-3-20-26-29(22(32-20)23-19(30)14-31-4-2)13-15-9-11-16(12-10-15)17-7-5-6-8-18(17)21-24-27-28-25-21/h5-12,20,26H,3-4,13-14H2,1-2H3,(H,24,25,27,28)/b23-22- |
| InChIKey | XSTPDSYHZKVWGV-FCQUAONHSA-N |
| XLogP | 3.24 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.56 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|