C23H28N6S — CID 57000351
5-methyl-N-pentyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,3-thiazolidin-2-imine (PubChem CID 57000351) has the molecular formula C23H28N6S and a molecular weight of 420.59 g/mol. Its IUPAC name is 5-methyl-N-pentyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,3-thiazolidin-2-imine.
| Compound Name | 5-methyl-N-pentyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,3-thiazolidin-2-imine |
|---|---|
| PubChem CID | 57000351 |
| Molecular Formula | C23H28N6S |
| Molecular Weight | 420.59 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | 5-methyl-N-pentyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,3-thiazolidin-2-imine |
| SMILES | CCCCC/N=C1\SC(C)CN1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C23H28N6S/c1-3-4-7-14-24-23-29(15-17(2)30-23)16-18-10-12-19(13-11-18)20-8-5-6-9-21(20)22-25-27-28-26-22/h5-6,8-13,17H,3-4,7,14-16H2,1-2H3,(H,25,26,27,28)/b24-23- |
| InChIKey | MHEHMJOUGSPTAB-VHXPQNKSSA-N |
| XLogP | 5.02 |
| TPSA | 70.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.59 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|