C12H16BrN3O5 — CID 56975476
2-bromo-N-[(2S,5R)-2-(hydroxymethyl)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]acetamide (PubChem CID 56975476) has the molecular formula C12H16BrN3O5 and a molecular weight of 362.18 g/mol. Its IUPAC name is 2-bromo-N-[(2S,5R)-2-(hydroxymethyl)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]acetamide.
| Compound Name | 2-bromo-N-[(2S,5R)-2-(hydroxymethyl)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]acetamide |
|---|---|
| PubChem CID | 56975476 |
| Molecular Formula | C12H16BrN3O5 |
| Molecular Weight | 362.18 g/mol |
| Exact Mass | 361.03 |
| IUPAC Name | 2-bromo-N-[(2S,5R)-2-(hydroxymethyl)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]acetamide |
| SMILES | Cc1cn([C@H]2CC(NC(=O)CBr)[C@@H](CO)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C12H16BrN3O5/c1-6-4-16(12(20)15-11(6)19)10-2-7(8(5-17)21-10)14-9(18)3-13/h4,7-8,10,17H,2-3,5H2,1H3,(H,14,18)(H,15,19,20)/t7?,8-,10-/m1/s1 |
| InChIKey | HDTGPNDVUGUNCR-JDOFKEMOSA-N |
| XLogP | -1.00 |
| TPSA | 113.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.18 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|