C6H12N2O — CID 56977394
1-ethenyl-1,3,3-trimethylurea (PubChem CID 56977394) has the molecular formula C6H12N2O and a molecular weight of 128.17 g/mol. Its IUPAC name is 1-ethenyl-1,3,3-trimethylurea.
| Compound Name | 1-ethenyl-1,3,3-trimethylurea |
|---|---|
| PubChem CID | 56977394 |
| Molecular Formula | C6H12N2O |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.09 |
| IUPAC Name | 1-ethenyl-1,3,3-trimethylurea |
| SMILES | C=CN(C)C(=O)N(C)C |
| InChI | InChI=1S/C6H12N2O/c1-5-8(4)6(9)7(2)3/h5H,1H2,2-4H3 |
| InChIKey | ATEGJFUKNUYDGP-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |